Knowledge

What synthesizes gonadorelin?

Oct 27, 2023 Leave a message

Gonadorelin is a peptide hormone composed of 10 amino acid residues, with a molecular formula of C53H74N16O13 and a relative molecular weight of 1218.36. It is a white or almost white powder, almost odorless and tasteless. Soluble in dilute acid and alkaline solutions, but insoluble in organic solvents and water. Almost insoluble in pure water, but soluble in acidic or alkaline solutions. It has high crystallinity and can crystallize into various forms, including needle like, sheet like, etc. The molecular structure consists of 10 amino acid residues, including 5 L-amino acid residues and 5 D-amino acid residues. These amino acid residues are linked by peptide bonds to form polypeptide chains. In the molecular structure, the alternating arrangement of D-amino acid residues and L-amino acid residues forms a relatively symmetrical structure. As a peptide hormone, it has relatively stable chemical properties. Under suitable conditions, it is not prone to chemical reactions such as hydrolysis and oxidation. However, under certain conditions, such as strong acids, bases, or high temperatures, Gonadorelin may undergo some chemical changes, such as side chain breakage, cross-linking, etc.

(Product linkhttps://www.bloomtechz.com/synthetic-chemical/peptide/gonadorelin-powder-cas-34973-08-5.html ) 

Gonadorelin | Shaanxi BLOOM Tech Co., Ltd

The above laboratory synthesis method for Gonadorelin mainly includes the following steps and their chemical reaction equations:

1. Prepare reaction vessel and reagents: Add PSS and deionized water to a three necked flask, and add EDOT under mechanical stirring. PSS is sodium polystyrene sulfonate, a polymer resin that can interact with functional groups such as carboxyl and amino groups, and is commonly used in solid-phase synthesis of peptides. EDOT is a commonly used epoxy compound that can react with functional groups such as amino groups.

2. Oxidizing agent triggers reaction: Add an aqueous solution of oxidizing agent, such as sodium persulfate and iron sulfate, through a constant pressure drop funnel. Sodium persulfate is a strong oxidant that can oxidize EDOT to generate corresponding epoxy compounds. Iron sulfate can serve as a catalyst to accelerate the oxidation reaction. At this point, the EDOT in the reaction vessel reacts with PSS to generate the corresponding epoxy compound.

3. Solid phase peptide synthesis: While maintaining mechanical stirring, the growing peptide chains are separated from the carrier and extended. This step usually involves adding suitable solvents, peptide chain carriers, and other necessary reagents such as amino acids, condensation agents, etc.

4. Separation and purification: Separation and purification are carried out through column chromatography to remove unreacted EDOT, PSS, and other impurities. Column chromatography is a commonly used separation and purification method that achieves separation by varying the distribution coefficients of different substances between the stationary and mobile phases.

5. Testing and quality analysis: Finally, conduct quality and purity testing to confirm that the synthesized Gonadorelin meets the requirements. Mass spectrometry, nuclear magnetic resonance, high-performance liquid chromatography, and other methods are usually used for quality and purity detection.

The chemical reaction equation is as follows:

(CH3)2C(O)CH2CH(OH)CH2OH + 2Na2S2O8 → (CH3)2C(O)CH2CH(OH)CH2O2Na+ 2Na2SO4

(CH3)2C(O)CH2CH(OH)CH2O2Na+PSS-COOH → PSS-CO-[(CH3)2C(O)CH2CH(OH)CH2OH] + NaOH

PSS-CO-[(CH3)2C(O)CH2CH(OH)CH2OH] + H2N-R-NH2->PSS-CO-[(CH3)2C(O)CH2CH(OH)CH2OH]- R-NH2 + NaOH

Among them, (CH3)2C(O)CH2CH(OH)CH2OH represents EDOT, PSS-COOH represents the carboxyl endpoint of PSS, and H2N-R-NH2 represents amino acids. The specific chemical reactions may vary depending on the experimental conditions.

Peptide- Shaanxi BLOOM Tech Co Ltd Price list

Fragment combination method is a commonly used chemical synthesis method that can be used to synthesize peptide hormones, such as Gonadorelin. The following are the detailed steps of the fragment combination method and its corresponding chemical equations:

1. Synthesis of fragments

In the fragment combination method, the first step is to synthesize the various fragments that make up peptide hormones. Fragments are usually synthesized using either solid-phase synthesis or liquid-phase synthesis methods.

Solid phase synthesis is a commonly used method for fragment synthesis. In this method, a solid phase carrier (such as polystyrene resin) is used as a support and the length of the peptide chain is gradually extended through chain growth reaction.

Liquid phase synthesis is a relatively early method for fragment synthesis. In this method, different amino acids are used as raw materials and the length of the peptide chain is gradually extended through condensation reaction.

Chemical equation:

Taking the solid-state synthesis method as an example, assuming the synthesis of a peptide chain segment composed of four amino acids, the following chemical equation can be used to represent it:

COOH-NH-CH2-CH2-CH2-CH2-CO-NH-CH(CH3)-COOH → COOH-NH-CH2-CH2-CH2-CO-NH-CH (CH3) - COOH + H2O

Among them, COOH-NH-CH2-CH2-CH2-COOH represents the starting amino acid (such as lysine), NH2-CH(CH3)-COOH represents the second amino acid (such as alanine), and COOH-NH-CH2-CH2-CH2-CH2-CO-NH-CH(CH3)-COOH represents the synthesized peptide chain fragment.

2. Connection of fragments

After the completion of fragment synthesis, a connection reaction is required to connect each fragment to obtain the final peptide hormone. DCC (Dicyclohexylcarbodiimide) is usually used as a linker to promote the connection reaction.

Chemical equation:

Assuming that two synthesized peptide fragments A and B are to be connected, the following chemical equation can be used to represent:

COOH-NH-CH2-CH2-CH2-CH2-CO-NH-CH(CH3)-COOH + NH2-CH(CH3)-COOH → COOH-NH-CH2-CH2-CH2-CH2-CO-NH-(CH (CH3)-COOH)2 +H2O

Among them, COOH-NH-CH2-CH2-CH2-CH2-CO-NH-(CH (CH3)-COOH)2 represents the peptide hormone after connection.

It should be noted that each step of the reaction in the fragment combination method requires the selection of appropriate solvents and reagents to ensure the smooth progress of the reaction and the purity of the product. In addition, during the fragment connection stage, it is necessary to select appropriate linkers and reaction conditions to ensure the efficiency of the connection reaction and the purity of the product.

 

Gonadorelin is a peptide hormone with extensive clinical applications. However, due to the complexity of its mechanism of action and individual differences, the use of Gonadorelin still faces certain challenges.

Firstly, although Gonadorelin plays an important role in promoting gonadotropin secretion and reproductive organ development, its mechanism of action is not yet fully understood. Therefore, further research needs to reveal its mechanism of action in order to better understand its physiological and pharmacological effects.

Secondly, there are individual differences in the therapeutic efficacy of Gonadorelin. Some patients may not respond well to Gonadorelin treatment, which may be related to factors such as the patient's genetic background, lifestyle habits, and other diseases. Therefore, further research is needed to determine these influencing factors in order to better predict patient responses.

In addition, the synthesis and production process of Gonadorelin is relatively complex, and more effective synthesis and production methods need to be developed to improve yield and purity. Meanwhile, due to the small molecular weight of Gonadorelin, its stability is poor, and further research is needed to explore how to improve its stability.

Despite these challenges, Gonadorelin still has broad prospects for development. With the continuous progress of science and technology and the accumulation of clinical application experience, we can expect to make more progress in the research and treatment of Gonadorelin in the future. For example, by studying its mechanism of action and influencing factors, we can better understand its physiological and pharmacological effects, thereby providing patients with more effective treatment options. Meanwhile, by improving synthesis and production methods, we can increase yield and purity, thereby reducing treatment costs and improving accessibility.

Send Inquiry