Diisopropylammonium is an organic compound with CAS 660-27-5 and molecular formula C6H15NCl2O2. It usually exists in a solid form of white or light yellow. It has crystallinity, so it can be purified by crystallization or recrystallization methods. Easy to dissolve in water, slightly soluble in ethanol, insoluble in ether. It can be used as an intermediate in the synthesis of organic compounds. By reacting with different reactants, various organic compounds can be generated. For example, it can react with halogenated hydrocarbons to generate corresponding halogenated esters, and react with alcohols to generate corresponding esters, etc.
(Product link: https://www.bloomtechz.com/chemical-reagent/indicator-reagent/diisopropylammonium-cas-660-27-5.html )
The ester exchange method is a method of synthesizing diisopropyllammonium dichloroacetate through esterification and ester exchange reactions.
1. Experimental Principles
The ester exchange method involves reacting isopropylamine with acetic acid to produce isopropylamine acetate, which then undergoes ester exchange with dichloroacetic acid to produce diisopropyllammonium dichloroacetate. This reaction is a combination of acid-base neutralization reaction and ester exchange reaction. By controlling the reaction conditions, high purity products can be obtained.
2. Experimental steps
Preparation of raw materials: isopropylamine, acetic acid, dichloroacetic acid, appropriate amount of water, organic solvents (such as ether or toluene).
Add an appropriate amount of isopropylamine to water and stir evenly.
Slowly add acetic acid to the isopropylamine solution while stirring evenly.
During the reaction process, observe the color change of the solution. When the solution turns pale yellow, it indicates that isopropylamine acetate has been generated.
Extract with organic solvents to separate the generated isopropylamine acetate.
Slowly add dichloroacetic acid to the isopropylamine acetate solution while stirring evenly.
During the reaction process, observe the color change of the solution. When the solution turns pale yellow, it indicates that Diisopropylammonium dichloroacetate has been generated.
Extract using organic solvents to separate the generated Diisopropylammonium dichloroacetate.
Purify the product by distillation or other methods to obtain pure Diisopropylammonium dichloroacetate.
3. Chemical equation
The reaction between isopropylamine and acetic acid produces isopropylamine acetate:
H2NC(CH3)CH2NH2 + CH3COOH + H2O → CH3COOHCH(CH3)NHCH2CH2NH2 + HCl
Isopropylammonium acetate undergoes ester exchange reaction with dichloroacetic acid to form Diisopropylammonium dichloroacetate:
CH3COOHCH(CH3)NHCH2CH2NH2 + CH2ClCH2COOH + H2O → CH3CH(CH3)NHCH2CH2ClCH2COOH + HCl + CH3COOH
Amination method is a method for synthesizing Diisopropylammonium dichloroacetate. Its basic principle is to convert dichloroacetic acid into the corresponding amine salt through amination reaction, and then undergo a series of chemical reactions to obtain the target product.
1. Experimental Principles
The amination method involves reacting dichloroacetic acid with ammonia or its derivatives to generate the corresponding amine salt. Then, the amine salt is reacted with isopropylamine to produce Diisopropylammonium dichloroacetate. This reaction is a combination of acid-base neutralization reaction and substitution reaction. By controlling the reaction conditions, high purity products can be obtained.
2. Experimental steps
Preparation of raw materials: dichloroacetic acid, ammonia, isopropylamine, appropriate amount of water, organic solvents (such as ether or toluene).
Add an appropriate amount of dichloroacetic acid to water and stir evenly.
Slowly add ammonia to the dichloroacetic acid solution while stirring evenly.
During the reaction process, observe the color change of the solution. When the solution turns pale yellow, it indicates that dichloroacetic acid amine has been generated.
Extract with organic solvents to separate the generated dichloroacetic amine.
Slowly add isopropylamine to the dichloroacetic amine solution while stirring evenly.
During the reaction process, observe the color change of the solution. When the solution turns pale yellow, it indicates that Diisopropylammonium dichloroacetate has been generated.
Extract using organic solvents to separate the generated Diisopropylammonium dichloroacetate.
Purify the product by distillation or other methods to obtain pure Diisopropylammonium dichloroacetate.
3. Chemical equation
Dichloroacetic acid reacts with ammonia to produce amine dichloroacetate:
H2C=C(Cl)COOH + NH3 + H2O → H2C=C(NH2)COOH + HCl
Dichloroacetamide reacts with isopropylamine to form Diisopropylammonium dichloroacetate:
H2C=C(NH2)COOH + H2NCH(CH3)CH2NH2 + H2O → CH3CH(CH3)NHCH2CH2NH2C(Cl)COOH + HCl + H2NCH(CH3)CH2NHCH2CH2NH2
Esterification amination method is a method for synthesizing Diisopropylammonium dichloroacetate, which combines the advantages of esterification and amination reactions and achieves the synthesis of the target product through a two-step reaction. The following are the detailed steps of this method and its corresponding chemical equations:
1. Experimental Principles
The esterification amination method first reacts dichloroacetic acid with acetic acid through esterification to produce dichloroacetic acid acetate, and then reacts with isopropylamine through amination to produce diisopropyllammonium dichloroacetate. This method can obtain high purity products by controlling reaction conditions.
2. Experimental steps
Preparation of raw materials: dichloroacetic acid, acetic acid, isopropylamine, appropriate amount of water, organic solvents (such as ether or toluene).
Add an appropriate amount of dichloroacetic acid to water and stir evenly.
Slowly add acetic acid to the dichloroacetic acid solution while stirring evenly.
During the reaction process, observe the color change of the solution. When the solution turns pale yellow, it indicates that dichloroacetic acid acetate has been generated.
Extract with organic solvents to separate the generated dichloroacetic acid acetate.
Slowly add isopropylamine to the dichloroacetic acid ester solution while stirring evenly.
During the reaction process, observe the color change of the solution. When the solution turns pale yellow, it indicates that Diisopropylammonium dichloroacetate has been generated.
Extract using organic solvents to separate the generated Diisopropylammonium dichloroacetate.
Purify the product by distillation or other methods to obtain pure Diisopropylammonium dichloroacetate.
3. Chemical equation
Dichloroacetic acid reacts with acetic acid to produce dichloroacetic acid acetate:
H2C=C(Cl)COOH + CH3COOH + H2O → CH3COOCH2C(Cl)COOH + HCl
Dichloroacetic acid ester reacts with isopropylamine to form diisopropyllammonium dichloroacetate:
CH3COOCH2C(Cl)COOH + H2NCH(CH3)CH2NH2 + H2O → CH3CH(CH3)NHCH2CH2NH2C(Cl)COOH + HCl + CH3COOH+H2NCH(CH3)CH2NHCH2CH2NH2
When selecting and balancing the synthesis method of Diisopropylammonium dichloroacetate, the following aspects need to be considered:
1. Raw material cost: Different synthesis methods require the use of different raw materials, so the cost of raw materials is one of the factors to consider when selecting a method. The esterification amination method requires the use of acetic acid and isopropylamine, while the amination method requires the use of ammonia water. Therefore, a suitable method can be selected based on the supply and price of raw materials.
2. Reaction conditions: Different synthesis methods require different reaction conditions, including temperature, pressure, reaction time, etc. When selecting methods, it is necessary to consider factors such as laboratory conditions and equipment, as well as operational simplicity and safety.
3. Product quality: The purity of products obtained by different synthesis methods may vary, so it is necessary to choose the appropriate method based on product quality requirements. At the same time, it is also necessary to consider the difficulty of product post-processing and purification.
4. Environmental friendliness: When choosing a synthesis method, it is necessary to consider its impact on the environment. Both esterification amination and amination methods involve the use of organic solvents, and attention should be paid to the recovery and treatment of solvents to reduce their impact on the environment.
Taking into account the above factors, a suitable synthesis method can be selected based on the actual situation. If there is a high demand for product quality, the esterification amination method can be chosen; If there are high requirements for raw material cost and environmental friendliness, the amination method can be chosen. Meanwhile, suitable methods can also be selected based on laboratory conditions and equipment.